CAS 1214386-79-4

1-Bromo-2-(difluoromethyl)-4-(trifluoromethyl)benzene

Description:

1-Bromo-2-(difluoromethyl)-4-(trifluoromethyl)benzene is an aromatic compound characterized by the presence of a bromine atom and multiple fluorine substituents on a benzene ring. Specifically, it features a bromine atom at the first position, a difluoromethyl group at the second position, and a trifluoromethyl group at the fourth position of the benzene ring. This compound is notable for its high electronegativity due to the fluorine atoms, which can significantly influence its reactivity and physical properties. It is likely to be a colorless to pale yellow liquid or solid, depending on temperature and purity. The presence of multiple fluorine atoms enhances its stability and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound's unique structure may impart specific properties such as increased boiling point and lower volatility compared to non-fluorinated analogs. Safety considerations should be taken into account due to the potential toxicity of halogenated compounds.

Formula: C₈H₄BrF₅

InChI: InChI=1S/C8H4BrF5/c9-6-2-1-4(8(12,13)14)3-5(6)7(10)11/h1-3,7H

InChI key: InChIKey=BFNGINWHJGOHKW-UHFFFAOYSA-N

SMILES: C(F)(F)C1=CC(C(F)(F)F)=CC=C1Br

Synonyms:

• Benzene, 1-bromo-2-(difluoromethyl)-4-(trifluoromethyl)-
• 1-Bromo-2-(difluoromethyl)-4-(trifluoromethyl)benzene

2-Bromo-5-(trifluoromethyl)benzodifluoride (stabilized over Potassium carbonate)

CAS: 1214386-79-4

Formula: C₈H₄BrF₅

Molecular weight: 275.016

Ref: 10-F104212