CAS 1214387-07-1

4-Chloro-2-(trifluoromethyl)-1,1′-biphenyl

Description:

4-Chloro-2-(trifluoromethyl)-1,1′-biphenyl, identified by its CAS number 1214387-07-1, is an organic compound characterized by the presence of a biphenyl structure with a chlorine atom and a trifluoromethyl group attached to the aromatic rings. This compound typically exhibits a high degree of lipophilicity due to the presence of the trifluoromethyl group, which can influence its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in materials science and organic synthesis. The chlorine and trifluoromethyl substituents can impart unique electronic properties, making it of interest in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit stability under various conditions, although its reactivity can be influenced by the presence of other functional groups or environmental factors. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks.

Formula: C₁₃H₈ClF₃

InChI: InChI=1S/C13H8ClF3/c14-10-6-7-11(9-4-2-1-3-5-9)12(8-10)13(15,16)17/h1-8H

InChI key: InChIKey=ACFVDKNMQJPXAO-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C=CC(Cl)=C1)C2=CC=CC=C2

Synonyms:

• 4-Chloro-2-(trifluoromethyl)-1,1′-biphenyl
• 1,1′-Biphenyl, 4-chloro-2-(trifluoromethyl)-

1,1′-Biphenyl, 4-chloro-2-(trifluoromethyl)-

CAS: 1214387-07-1

Formula: C₁₃H₈ClF₃

Purity: 96%

Molecular weight: 256.6508

Ref: IN-DA01R5GF