CAS 1214390-27-8

Methyl [3,3′-bipyridine]-6-carboxylate

Description:

Methyl [3,3′-bipyridine]-6-carboxylate is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 3-position. This compound features a carboxylate functional group, which contributes to its reactivity and solubility in polar solvents. The methyl ester group enhances its volatility and can influence its interaction with biological systems. Typically, compounds like this are used in various applications, including organic synthesis, coordination chemistry, and as ligands in metal complexation. The presence of the bipyridine moiety often imparts interesting electronic properties, making it suitable for applications in catalysis and materials science. Additionally, the compound's structure allows for potential hydrogen bonding and π-π stacking interactions, which can be significant in supramolecular chemistry. Overall, Methyl [3,3′-bipyridine]-6-carboxylate is a versatile compound with potential utility in both academic research and industrial applications.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c1-16-12(15)11-5-4-10(8-14-11)9-3-2-6-13-7-9/h2-8H,1H3

InChI key: InChIKey=LLRIDSFUOBCANW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=CC(=CN1)C=2C=CC=NC2

Synonyms:

• Methyl [3,3′-bipyridine]-6-carboxylate
• [3,3′-Bipyridine]-6-carboxylic acid, methyl ester