CAS 1214391-36-2

2-Bromo-3-fluoro-α-hydroxybenzeneacetic acid

Description:

2-Bromo-3-fluoro-α-hydroxybenzeneacetic acid is an organic compound characterized by the presence of a bromine atom and a fluorine atom on a benzene ring, along with a hydroxyl group and an acetic acid moiety. This compound features a phenolic structure, which contributes to its potential reactivity and solubility in polar solvents. The presence of the bromine and fluorine substituents can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The α-hydroxy group indicates that it may exhibit acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, where such functional groups are often critical for biological activity. Its specific interactions and stability would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other reactive species. Overall, 2-Bromo-3-fluoro-α-hydroxybenzeneacetic acid is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₈H₆BrFO₃

InChI: InChI=1S/C8H6BrFO3/c9-6-4(7(11)8(12)13)2-1-3-5(6)10/h1-3,7,11H,(H,12,13)

InChI key: InChIKey=WELYXWJDFDYZHA-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=C(Br)C(F)=CC=C1

Synonyms:

• Benzeneacetic acid, 2-bromo-3-fluoro-α-hydroxy-
• 2-Bromo-3-fluoro-α-hydroxybenzeneacetic acid