CAS 121449-71-6
:Dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol
Description:
Dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol, with CAS number 121449-71-6, is a polycyclic aromatic compound characterized by its complex structure, which includes two fused benzene rings and a dioxin moiety. This compound features hydroxyl groups at specific positions, contributing to its potential reactivity and solubility in various solvents. Dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol is of interest in environmental chemistry due to its potential formation as a byproduct in combustion processes and its implications in toxicology. The presence of multiple hydroxyl groups may enhance its interaction with biological systems, potentially influencing its toxicity and bioavailability. As with many dioxin-related compounds, it is essential to consider its persistence in the environment and its potential for bioaccumulation. Research into its properties, including stability, reactivity, and biological effects, is crucial for understanding its environmental impact and health risks associated with exposure.
Formula:C12H8O6
InChI:InChI=1S/C12H8O6/c13-5-1-7(15)11-9(3-5)18-12-8(16)2-6(14)4-10(12)17-11/h1-4,13-16H
InChI key:InChIKey=YGRMPMIDAOECSI-UHFFFAOYSA-N
SMILES:OC1=C2C(OC=3C(O2)=CC(O)=CC3O)=CC(O)=C1
Synonyms:- Dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
