CAS 121456-55-1
:3'-azido-5'-O-benzyl-3'-deoxythymidine
Description:
3'-Azido-5'-O-benzyl-3'-deoxythymidine, commonly referred to as AZT or a derivative of thymidine, is a nucleoside analog characterized by the presence of an azido group at the 3' position and a benzyl group at the 5' position of the thymidine structure. This compound is notable for its potential antiviral properties, particularly in the context of HIV treatment, as it can interfere with viral replication by mimicking natural nucleosides. The azido group enhances its reactivity and incorporation into viral DNA, while the benzyl group contributes to its lipophilicity, potentially affecting its bioavailability and cellular uptake. The compound is typically synthesized through specific organic reactions that modify the thymidine backbone, and its structure allows for various modifications that can enhance its pharmacological profile. As a research chemical, it is primarily utilized in studies related to antiviral drug development and nucleoside chemistry. Safety and handling precautions are essential due to its reactive nature and potential biological effects.
Formula:C17H19N5O4
InChI:InChI=1/C17H19N5O4/c1-11-8-22(17(24)19-16(11)23)15-7-13(20-21-18)14(26-15)10-25-9-12-5-3-2-4-6-12/h2-6,8,13-15H,7,9-10H2,1H3,(H,19,23,24)/t13-,14+,15+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3'-Azido-5'-O-benzoyl-3'-deoxythymidine
CAS:3'-Azido-5'-O-benzoyl-3'-deoxythymidine is a novel antiviral agent that is synthesized by modifying the structure of thymidine. It has been shown to have high antiviral activity against HIV and other viruses in vitro. 3'-Azido-5'-O-benzoyl-3'-deoxythymidine also inhibits tumor growth in animal models and may be useful as an anticancer drug. This compound is found to be active against a number of cancers, including leukemia, colon cancer, and prostate cancer. 3'-Azido-5'-O-benzoyl-3'-deoxythymidine is phosphoramidites for DNA synthesis, which can be used in the production of ribonucleosides or deoxyribonucleosides.Formula:C17H19N5O4Purity:Min. 95%Molecular weight:357.36 g/mol

