CymitQuimica logo

CAS 121456-63-1

:

Ethanone, 1-(2,6-dimethylphenyl)-2,2,2-trifluoro- (9CI)

Description:
Ethanone, 1-(2,6-dimethylphenyl)-2,2,2-trifluoro- is an organic compound characterized by its ketone functional group, which is central to its structure. The presence of the trifluoromethyl group (–CF3) significantly influences its chemical properties, enhancing its lipophilicity and stability. The compound features a 2,6-dimethylphenyl group, contributing to its aromatic character and potentially affecting its reactivity and interactions with other molecules. This compound is typically colorless to pale yellow in appearance and may have a distinctive odor. It is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the trifluoromethyl group. The trifluoromethyl group also imparts unique electronic properties, making the compound of interest in various chemical applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence. Overall, this compound exemplifies the interplay between functional groups and molecular structure in determining chemical behavior.
Formula:C10H9F3O
InChI:InChI=1/C10H9F3O/c1-6-4-3-5-7(2)8(6)9(14)10(11,12)13/h3-5H,1-2H3
InChI key:ZCXOVQMIBTWGCB-UHFFFAOYSA-N
SMILES:Cc1cccc(C)c1C(=O)C(F)(F)F
Synonyms:
  • 1-(2,6-Dimethylphenyl)-2,2,2-Trifluoroethanone
Found 2 products.