
CAS 121459-89-0: 5H-Pyrido[1′,2′:4,5][1,2,4]thiadiazino[2,3-a]benzimidazol-13-ium, 3,9-dimethoxy-2,4-dimethyl-, chloride
Description:5H-Pyrido[1′,2′:4,5][1,2,4]thiadiazino[2,3-a]benzimidazol-13-ium, 3,9-dimethoxy-2,4-dimethyl-, chloride is a complex organic compound characterized by its unique bicyclic structure that incorporates both thiadiazine and benzimidazole moieties. This compound features a pyridine-like nitrogen atom, contributing to its potential basicity and reactivity. The presence of methoxy and methyl substituents enhances its solubility and may influence its biological activity. As a chloride salt, it is likely to exhibit ionic characteristics, which can affect its stability and interaction with other substances. The compound may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its intricate structure suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its toxicity, bioavailability, and mechanism of action would be necessary to fully understand its potential uses and safety profile. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry.
Formula:C17H18N3O2S·Cl
InChI:InChI=1S/C17H18N3O2S.ClH/c1-10-8-19-15(11(2)16(10)22-4)9-23-20-14-7-12(21-3)5-6-13(14)18-17(19)20;/h5-8H,9H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=QAZLUNIWYYOJPC-UHFFFAOYSA-M
SMILES:[Cl-].N=1C2=CC=C(OC)C=C2N3SCC=4C(=C(OC)C(=C[N+]4C13)C)C
- Synonyms:
- 5H-Pyrido[1′,2′:4,5][1,2,4]thiadiazino[2,3-a]benzimidazol-13-ium, 3,9-dimethoxy-2,4-dimethyl-, chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Omeprazole Impurity 60 REF: 4Z-O-02144CAS: 121459-89-0 | - - - | To inquire | Thu 20 Mar 25 |

Ref: 4Z-O-02144
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |