
CAS 12146-37-1
:Tetracarbonyl(norbornadiene)molybdenum
Description:
Tetracarbonyl(norbornadiene)molybdenum, with the CAS number 12146-37-1, is a coordination complex of molybdenum featuring norbornadiene as a ligand. This compound is characterized by its unique structure, where a molybdenum center is coordinated to four carbonyl (CO) groups and one norbornadiene molecule. The presence of the norbornadiene ligand imparts interesting reactivity and stability to the complex, making it a subject of interest in organometallic chemistry. Tetracarbonyl(norbornadiene)molybdenum typically exhibits a low melting point and is soluble in organic solvents, which facilitates its use in various chemical reactions. The carbonyl ligands contribute to its electronic properties, allowing for potential applications in catalysis and materials science. Additionally, the compound can undergo various transformations, including ligand substitution and oxidative addition, making it versatile in synthetic chemistry. Overall, tetracarbonyl(norbornadiene)molybdenum is an important compound in the study of transition metal complexes and their applications in catalysis and organic synthesis.
Formula:C11H8MoO4
InChI:InChI=1S/C7H8.4CO.Mo/c1-2-7-4-3-6(1)5-7;4*1-2;/h1-4,6-7H,5H2;;;;;
InChI key:InChIKey=UZHYHBPCAGKHGZ-UHFFFAOYSA-N
SMILES:C(#O)[Mo]123(C#O)(C#O)(C#O)[CH]4=[CH]1C5[CH]2=[CH]3C4C5
Synonyms:- 2,5-Norbornadienemolybdenum tetracarbonyl
- [(2,3,5,6-η)-Bicyclo[2.2.1]hepta-2,5-diene]tetracarbonylmolybdenum
- Molybdenum, tetracarbonyl(2,5-norbornadiene)-
- Molybdenum, [(2,3,5,6-η)-bicyclo[2.2.1]hepta-2,5-diene]tetracarbonyl-
- Bicyclo[2.2.1]hepta-2,5-diene, molybdenum complex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.