CAS 1214622-42-0

2-Pyridinemethanamine, N-4-piperidinyl-, hydrochloride (1:3)

Description:

2-Pyridinemethanamine, N-4-piperidinyl-, hydrochloride (1:3) is a chemical compound characterized by its structure, which includes a pyridine ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The presence of both the pyridine and piperidine groups suggests potential interactions with biological systems, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atoms in its structure, which can participate in hydrogen bonding and influence its reactivity and solubility. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.

Formula: C₁₁H₁₇N₃·3ClH

InChI: InChI=1S/C11H17N3.3ClH/c1-2-6-13-11(3-1)9-14-10-4-7-12-8-5-10;;;/h1-3,6,10,12,14H,4-5,7-9H2;3*1H

InChI key: InChIKey=YUIPUMVZUQFVBD-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=CC=CC=N2.Cl

Synonyms:

• 2-Pyridinemethanamine, N-4-piperidinyl-, hydrochloride (1:3)

N-[(Pyridin-2-yl)methyl]piperidin-4-amine trihydrochloride

CAS: 1214622-42-0

Versatile small molecule scaffold

Formula: C₁₁H₂₀Cl₃N₃

Purity: Min. 95%

Molecular weight: 300.7 g/mol

Ref: 3D-PYB62242