
CAS 1214622-45-3
:5-Methoxy-2-(1H-pyrazol-1-yl)benzoic acid
Description:
5-Methoxy-2-(1H-pyrazol-1-yl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group and a pyrazole moiety. This compound features a benzoic acid backbone, indicating the presence of a carboxylic acid functional group that contributes to its acidity and potential reactivity. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. The pyrazole ring, a five-membered heterocyclic structure, can impart unique pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting inflammation or other biological pathways. The compound's CAS number, 1214622-45-3, allows for precise identification and retrieval of information regarding its synthesis, properties, and safety data. Overall, 5-Methoxy-2-(1H-pyrazol-1-yl)benzoic acid exemplifies a class of compounds that may exhibit diverse chemical behavior and biological activity due to its functional groups and structural features.
Formula:C11H10N2O3
InChI:InChI=1S/C11H10N2O3/c1-16-8-3-4-10(9(7-8)11(14)15)13-6-2-5-12-13/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=WKIHMOIUVBGYTC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(OC)=C1)N2C=CC=N2
Synonyms:- 5-Methoxy-2-(1H-pyrazol-1-yl)benzoic acid
- Benzoic acid, 5-methoxy-2-(1H-pyrazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.