CymitQuimica logo

CAS 1214622-47-5

:

3-Fluoro-2-(1H-pyrazol-1-yl)benzaldehyde

Description:
3-Fluoro-2-(1H-pyrazol-1-yl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a pyrazole moiety. The presence of a fluorine atom at the meta position relative to the aldehyde group influences its reactivity and polarity. This compound typically appears as a crystalline solid and is soluble in organic solvents, reflecting its non-polar aromatic characteristics. The pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit various chemical properties, such as reactivity towards nucleophiles due to the electrophilic nature of the aldehyde group. Its synthesis often involves methods that introduce the pyrazole and fluorine substituents onto the benzaldehyde framework. As with many fluorinated compounds, it may possess unique physical properties, such as altered boiling and melting points compared to its non-fluorinated analogs. Overall, 3-Fluoro-2-(1H-pyrazol-1-yl)benzaldehyde is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C10H7FN2O
InChI:InChI=1S/C10H7FN2O/c11-9-4-1-3-8(7-14)10(9)13-6-2-5-12-13/h1-7H
InChI key:InChIKey=WOGUYRVJKYRLIH-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C(F)=CC=C1)N2C=CC=N2
Synonyms:
  • 3-Fluoro-2-(1H-pyrazol-1-yl)benzaldehyde
  • Benzaldehyde, 3-fluoro-2-(1H-pyrazol-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.