CymitQuimica logo

CAS 1214622-53-3

:

3-Fluoro-2-(1H-pyrazol-1-yl)benzoic acid

Description:
3-Fluoro-2-(1H-pyrazol-1-yl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a fluorine atom and a pyrazole group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The pyrazole ring contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry for its possible applications in drug development. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence solubility in various solvents. Additionally, the specific arrangement of substituents can affect the compound's reactivity and interaction with biological targets. Overall, 3-Fluoro-2-(1H-pyrazol-1-yl)benzoic acid represents a versatile structure that may be explored for various chemical and pharmaceutical applications.
Formula:C10H7FN2O2
InChI:InChI=1S/C10H7FN2O2/c11-8-4-1-3-7(10(14)15)9(8)13-6-2-5-12-13/h1-6H,(H,14,15)
InChI key:InChIKey=WHPUSKHJEBOLKR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(F)=CC=C1)N2C=CC=N2
Synonyms:
  • Benzoic acid, 3-fluoro-2-(1H-pyrazol-1-yl)-
  • 3-Fluoro-2-(1H-pyrazol-1-yl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.