CymitQuimica logo

CAS 1214875-09-8

:

3,3-Difluoro-1-oxa-8-azaspiro[4.5]decane

Description:
3,3-Difluoro-1-oxa-8-azaspiro[4.5]decane is a chemical compound characterized by its unique spirocyclic structure, which consists of a fused bicyclic framework. The presence of the difluoro substituents indicates that there are two fluorine atoms attached to the carbon backbone, which can significantly influence the compound's reactivity and physical properties, such as polarity and boiling point. The "1-oxa" part of the name suggests that there is an oxygen atom incorporated into the ring structure, contributing to the compound's potential for hydrogen bonding and solubility in various solvents. The "8-aza" indicates the presence of a nitrogen atom within the spiro framework, which can affect the compound's biological activity and interaction with other molecules. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would require empirical data for precise evaluation.
Formula:C8H13F2NO
InChI:InChI=1S/C8H13F2NO/c9-8(10)5-7(12-6-8)1-3-11-4-2-7/h11H,1-6H2
InChI key:InChIKey=TXDBSMYUFFCTNM-UHFFFAOYSA-N
SMILES:FC1(F)CC2(OC1)CCNCC2
Synonyms:
  • 3,3-Difluoro-1-oxa-8-azaspiro[4.5]decane
  • 1-Oxa-8-azaspiro[4.5]decane, 3,3-difluoro-
  • 3,3-Difluoro-1-Oxa-8-Aza-Spiro[4.5]Decane
  • 3,3-Difluoro-1-Oxa-8-Aza-Spiro[4.5]Decane(WX100255)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.