CAS 1214875-26-9
:7,7-Difluoro-5-oxa-2-azaspiro[3.4]octane
Description:
7,7-Difluoro-5-oxa-2-azaspiro[3.4]octane is a chemical compound characterized by its unique spirocyclic structure, which consists of a nitrogen atom and an oxygen atom incorporated into a bicyclic framework. The presence of two fluorine atoms at the 7-position contributes to its distinctive electronic and steric properties, potentially enhancing its reactivity and solubility in various solvents. The compound's azaspiro configuration indicates that it contains a nitrogen atom within a spirocyclic arrangement, which can influence its biological activity and interaction with other molecules. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior in chemical reactions would depend on the functional groups present and the overall molecular geometry. As with many fluorinated compounds, it may also display unique characteristics such as increased lipophilicity and altered metabolic stability, which can be advantageous in pharmaceutical contexts.
Formula:C6H9F2NO
InChI:InChI=1S/C6H9F2NO/c7-6(8)1-5(10-4-6)2-9-3-5/h9H,1-4H2
InChI key:InChIKey=GJAUUPPAJTVUHL-UHFFFAOYSA-N
SMILES:FC1(F)CC2(OC1)CNC2
Synonyms:- 5-Oxa-2-azaspiro[3.4]octane, 7,7-difluoro-
- 7,7-Difluoro-5-oxa-2-azaspiro[3.4]octane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.