
CAS 1214875-47-4
:Octahydrofuro[3,2-c]pyridine
Description:
Octahydrofuro[3,2-c]pyridine is a bicyclic organic compound characterized by its unique fused ring structure, which combines a pyridine ring with a tetrahydrofuran moiety. This compound typically exhibits a colorless to pale yellow appearance and is soluble in various organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of nitrogen in the pyridine ring can influence its reactivity and polarity, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit interesting properties such as moderate to low volatility and stability under standard conditions. Its synthesis often involves multi-step reactions, and it may be derived from more complex organic precursors. As with many nitrogen-containing heterocycles, Octahydrofuro[3,2-c]pyridine may also display biological activity, warranting further investigation into its pharmacological potential.
Formula:C7H13NO
InChI:InChI=1S/C7H13NO/c1-3-8-5-6-2-4-9-7(1)6/h6-8H,1-5H2
InChI key:InChIKey=TXUAGBMPDJZPAN-UHFFFAOYSA-N
SMILES:C12C(OCC1)CCNC2
Synonyms:- 2,3,3a,4,5,6,7,7a-Octahydrofuro[3,2-c]pyridine
- Furo[3,2-c]pyridine, octahydro-
- Octahydrofuro[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.