CAS 121489-14-3
:2-[Methyl(3-pyridinylmethyl)amino]ethanol
Description:
2-[Methyl(3-pyridinylmethyl)amino]ethanol, with the CAS number 121489-14-3, is an organic compound characterized by its amine and alcohol functional groups. It features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the methyl group attached to the nitrogen atom enhances its lipophilicity, potentially influencing its interaction with biological membranes. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, affecting its solubility in water and organic solvents. The structural arrangement suggests that it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Additionally, due to its amine functionality, it may exhibit basic properties, allowing it to act as a proton acceptor in acid-base reactions. Overall, 2-[Methyl(3-pyridinylmethyl)amino]ethanol is of interest in medicinal chemistry and pharmacology, potentially serving as a lead compound for drug development or as a biochemical probe.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-11(5-6-12)8-9-3-2-4-10-7-9/h2-4,7,12H,5-6,8H2,1H3
InChI key:InChIKey=AONUOBNHKYQJIO-UHFFFAOYSA-N
SMILES:C(N(CCO)C)C=1C=CC=NC1
Synonyms:- JAY 22-23
- JAY 2-22-33
- 2-[Methyl(3-pyridinylmethyl)amino]ethanol
- 2-[Methyl(pyridin-3-ylmethyl)amino]ethan-1-ol
- Ethanol, 2-[methyl(3-pyridinylmethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
JAY2-22-33
CAS:JAY2-22-33 reduces Aβ toxicity, delays paralysis, and boosts cognition in AD mouse model.Formula:C9H14N2OColor and Shape:SolidMolecular weight:166.22
