CAS 1214900-47-6
:1,3-Dihydro-6-iodo-3,3-dimethyl-2H-indol-2-one
Description:
1,3-Dihydro-6-iodo-3,3-dimethyl-2H-indol-2-one is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The presence of an iodine atom at the 6-position enhances its reactivity and potential applications in various chemical reactions, including halogenation and nucleophilic substitutions. The 3,3-dimethyl groups contribute to steric hindrance, which can influence the compound's reactivity and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features can also lead to interesting photophysical properties, which may be explored in materials science. As with many indole derivatives, it may participate in diverse chemical reactions, making it a valuable compound in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of iodine and the potential biological activity of the compound.
Formula:C10H10INO
InChI:InChI=1S/C10H10INO/c1-10(2)7-4-3-6(11)5-8(7)12-9(10)13/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=GWOJFJPYMXRQEY-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(NC1=O)=CC(I)=CC2
Synonyms:- 1,3-Dihydro-6-iodo-3,3-dimethyl-2H-indol-2-one
- 2H-Indol-2-one, 1,3-dihydro-6-iodo-3,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
