CAS 1214902-65-4

2-Bromo[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid

Description:

2-Bromo[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid is a heterocyclic compound characterized by the presence of a triazole ring fused to a pyridine structure, along with a carboxylic acid functional group and a bromine substituent. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, including potential biological activity due to its structural features. The bromine atom introduces a halogen, which can enhance reactivity and influence the compound's solubility and stability. The carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, affecting its interactions in biological systems or with other chemical entities. This compound may be of interest in medicinal chemistry and material science due to its unique structural characteristics, which can lead to diverse applications, including as a building block in drug development or as a ligand in coordination chemistry. Its specific reactivity and applications would depend on the context of its use and the presence of other functional groups in related compounds.

Formula: C₇H₄BrN₃O₂

InChI: InChI=1S/C7H4BrN3O2/c8-7-9-5-3-1-2-4(6(12)13)11(5)10-7/h1-3H,(H,12,13)

InChI key: InChIKey=RYIYWYJKBZXUBW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NC(Br)=N2)C=CC1

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyridine-5-carboxylic acid, 2-bromo-
• 2-Bromo[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid