
CAS 121494-14-2
:N-[(1,1-Dimethylethoxy)carbonyl]-N-phenyl-β-alanine
Description:
N-[(1,1-Dimethylethoxy)carbonyl]-N-phenyl-β-alanine, with the CAS number 121494-14-2, is an amino acid derivative characterized by its unique structural features. This compound contains a β-alanine backbone, which is an amino acid known for its role in various biological processes. The presence of the N-phenyl group introduces aromatic characteristics, potentially influencing its solubility and reactivity. The 1,1-dimethylethoxycarbonyl group serves as a protective moiety, enhancing the stability of the molecule during synthetic procedures. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other bioactive compounds. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. Overall, N-[(1,1-Dimethylethoxy)carbonyl]-N-phenyl-β-alanine exemplifies the complexity and versatility of amino acid derivatives in chemical synthesis and applications.
Formula:C14H19NO4
InChI:InChI=1S/C14H19NO4/c1-14(2,3)19-13(18)15(10-9-12(16)17)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,16,17)
InChI key:InChIKey=YSMMPLIVJMNIFC-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(CCC(O)=O)C1=CC=CC=C1
Synonyms:- N-[(1,1-Dimethylethoxy)carbonyl]-N-phenyl-β-alanine
- β-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N-phenyl-
- 3-[[(tert-Butoxy)carbonyl](phenyl)amino]propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.