CAS 1215-07-2
:α-Nitrostilbene
Description:
α-Nitrostilbene is an organic compound characterized by its structure, which features a nitro group (-NO2) attached to one of the phenyl rings of stilbene, a compound consisting of two phenyl groups connected by a double bond. This compound typically appears as a yellow crystalline solid and is known for its photochemical properties, particularly its ability to undergo isomerization upon exposure to light. α-Nitrostilbene is also notable for its role in organic synthesis and as an intermediate in the production of various dyes and pharmaceuticals. It exhibits moderate solubility in organic solvents, such as ethanol and acetone, but is less soluble in water. The presence of the nitro group contributes to its reactivity, making it a useful compound in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, α-Nitrostilbene can be used in studies related to photochemistry and materials science due to its unique electronic properties. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C14H11NO2
InChI:InChI=1S/C14H11NO2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H
InChI key:InChIKey=QIFBVYLHLLTNLI-UHFFFAOYSA-N
SMILES:C(=CC1=CC=CC=C1)(N(=O)=O)C2=CC=CC=C2
Synonyms:- Stilbene, α-nitro-
- Benzene, 1,1′-(1-nitro-1,2-ethenediyl)bis-
- α′-Nitrostilbene
- α-Nitrostilbene
- 1,1′-(1-Nitro-1,2-ethenediyl)bis[benzene]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(1-Nitroethene-1,2-diyl)dibenzene
CAS:(1-Nitroethene-1,2-diyl)dibenzene (alpha-Nitrostilbene; α-Nitrostilbene) serves as an inhibitor of protein arginine methyltransferase 1 (PRMT1; histone H4 methylation assay with an IC50 of 11 μM). At concentrations of 10 and 100 μM, it also inhibits histone H4 methylation caused by PRMT8 but does not affect methylation of histone H3.1 induced by CARM1 or Set7/9.Formula:C14H11NO2Color and Shape:SolidMolecular weight:225.24±-Nitrostilbene
CAS:±-Nitrostilbene is a chemical compound that belongs to the group of phenylpropanoids. It has been shown to be a potent inhibitor of the ion channels TRPV1 and TRPA1, which are involved in pain signalling pathways. ±-Nitrostilbene also shows high affinity for certain receptors, such as the cannabinoid receptor CB2 and the opioid receptor KOR. This compound has been used for research in pharmacology and cell biology.
Formula:C14H11NO2Purity:Min. 95%Molecular weight:225.24 g/molRef: 3D-BAA21507
Discontinued product

