CAS 1215-42-5

Diazene, 1,2-bis(4-bromophenyl)-, 1-oxide

Description:

Diazene, 1,2-bis(4-bromophenyl)-, 1-oxide, also known by its CAS number 1215-42-5, is an organic compound characterized by the presence of a diazene functional group, which consists of a nitrogen-nitrogen double bond. This compound features two 4-bromophenyl groups attached to the diazene, contributing to its aromatic character and potentially influencing its reactivity and stability. The presence of the 1-oxide indicates that one of the nitrogen atoms is oxidized, which can affect the compound's electronic properties and reactivity. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential applications in organic synthesis or as intermediates in chemical reactions. The bromine substituents can enhance the compound's electrophilic character, making it useful in various chemical transformations. However, specific reactivity and stability can depend on the surrounding conditions, such as temperature and solvent. Overall, this compound is of interest in the field of synthetic organic chemistry and materials science.

Formula: C₁₂H₈Br₂N₂O

InChI: InChI=1S/C12H8Br2N2O/c13-9-1-5-11(6-2-9)15-16(17)12-7-3-10(14)4-8-12/h1-8H

InChI key: InChIKey=IPXUSIUMPSGLFK-UHFFFAOYSA-N

SMILES: N(=NC1=CC=C(Br)C=C1)(=O)C2=CC=C(Br)C=C2

Synonyms:

• NSC 36258
• Diazene, 1,2-bis(4-bromophenyl)-, 1-oxide
• 4,4′-Dibromoazoxybenzene
• Diazene, bis(4-bromophenyl)-, 1-oxide
• Azoxybenzene, 4,4′-dibromo-

Diazene, 1,2-bis(4-bromophenyl)-, 1-oxide

CAS: 1215-42-5

Formula: C₁₂H₈Br₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 356.0127

Ref: IN-DA001532

1,2-Bis(4-bromophenyl)diazene 1-oxide

CAS: 1215-42-5

1,2-Bis(4-bromophenyl)diazene 1-oxide

Purity: 98%

Molecular weight: 356.02g/mol

Ref: 54-OR1062123

4,4'-Dibromoazoxybenzene

CAS: 1215-42-5

4,4'-Dibromoazoxybenzene is a functional group that contains both amines and nitroso groups. The reaction scheme for the synthesis of this compound includes hydrazines, potassium hydroxide, acetonitrile, chloride, and alkylation. The nitrogen atom in 4,4'-dibromoazoxybenzene is an aromatic amine. Cancer cells are sensitive to molecules containing aromatic amines as a functional group.

Formula: C₁₂H₈Br₂N₂O

Purity: Min. 95%

Molecular weight: 356.01 g/mol

Ref: 3D-FD66291