CymitQuimica logo

CAS 1215-74-3

:

5-chloro-2-[(4-chloro-2-hydroxy-phenyl)methyl]phenol

Description:
5-Chloro-2-[(4-chloro-2-hydroxy-phenyl)methyl]phenol, with the CAS number 1215-74-3, is an organic compound that belongs to the class of phenolic compounds. It features a chlorinated phenol structure, which contributes to its potential biological activity. The presence of multiple chlorine and hydroxyl groups enhances its reactivity and solubility in various solvents. This compound is characterized by its aromatic nature, which often leads to significant interactions with biological systems, making it of interest in fields such as medicinal chemistry and environmental science. Its molecular structure suggests potential applications in pharmaceuticals, particularly as an antimicrobial or antifungal agent, due to the presence of the hydroxyl group that can participate in hydrogen bonding. Additionally, the chlorinated phenolic structure may impart stability and influence the compound's lipophilicity, affecting its bioavailability and distribution in biological systems. Safety and handling precautions are essential, as chlorinated compounds can pose environmental and health risks.
Formula:C13H10Cl2O2
InChI:InChI=1/C13H10Cl2O2/c14-10-3-1-8(12(16)6-10)5-9-2-4-11(15)7-13(9)17/h1-4,6-7,16-17H,5H2
SMILES:c1cc(cc(c1Cc1ccc(cc1O)Cl)O)Cl
Synonyms:
  • Phenol, 2,2'-methylenebis(5-chloro- (8CI)(9CI)
  • Nsc 3947
  • 2,2'-Methanediylbis(5-Chlorophenol)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.