CAS 1215073-37-2
:5-Bromo-2-[3-(trifluoromethyl)phenyl]pyridine
Description:
5-Bromo-2-[3-(trifluoromethyl)phenyl]pyridine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a phenyl group that carries a trifluoromethyl substituent. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly influence the compound's chemical behavior and stability. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its unique combination of functional groups may impart specific properties, such as lipophilicity and the ability to interact with biological targets. Additionally, the compound's molecular structure suggests potential applications in materials science and agrochemicals. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C12H7BrF3N
InChI:InChI=1S/C12H7BrF3N/c13-10-4-5-11(17-7-10)8-2-1-3-9(6-8)12(14,15)16/h1-7H
InChI key:InChIKey=MMQGMAGVZIROCJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C2=CC=C(Br)C=N2
Synonyms:- 5-Bromo-2-[3-(trifluoromethyl)phenyl]pyridine
- Pyridine, 5-bromo-2-[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
