CymitQuimica logo

CAS 1215074-04-6

:

2-Chloro-5-(3,5-difluorophenyl)thiazole

Description:
2-Chloro-5-(3,5-difluorophenyl)thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a chlorine atom at the 2-position and a 3,5-difluorophenyl group at the 5-position of the thiazole ring, contributing to its unique chemical properties. This substitution pattern can influence the compound's reactivity, solubility, and biological activity. Typically, thiazole derivatives exhibit a range of pharmacological activities, making them of interest in medicinal chemistry. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, which can be advantageous in drug design. The compound's molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and application. Overall, 2-Chloro-5-(3,5-difluorophenyl)thiazole represents a versatile scaffold for further chemical exploration and development.
Formula:C9H4ClF2NS
InChI:InChI=1S/C9H4ClF2NS/c10-9-13-4-8(14-9)5-1-6(11)3-7(12)2-5/h1-4H
InChI key:InChIKey=KJJSFHVTFYQBOM-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C2=CN=C(Cl)S2
Synonyms:
  • Thiazole, 2-chloro-5-(3,5-difluorophenyl)-
  • 2-Chloro-5-(3,5-difluorophenyl)thiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.