
CAS 1215074-46-6
:8-Fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine
Description:
8-Fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine is a chemical compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to a seven-membered nitrogen-containing ring. The presence of a fluorine atom at the 8-position contributes to its distinct chemical properties, potentially influencing its reactivity and biological activity. This compound is classified as a heterocyclic amine, and its tetrahydro configuration indicates that it contains four hydrogen atoms in the saturated rings, making it less reactive than its unsaturated counterparts. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the structural similarities to other bioactive compounds. Additionally, the fluorine substitution may enhance lipophilicity and metabolic stability, which are desirable traits in drug design. As with many heterocycles, the compound's properties, including solubility, stability, and interaction with biological targets, are influenced by its specific molecular architecture.
Formula:C10H12FN
InChI:InChI=1S/C10H12FN/c11-10-4-3-8-2-1-5-12-7-9(8)6-10/h3-4,6,12H,1-2,5,7H2
InChI key:InChIKey=FRQNUCOUUUBYIQ-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=CC1)CCCNC2
Synonyms:- 1H-2-Benzazepine, 8-fluoro-2,3,4,5-tetrahydro-
- 8-Fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.