CAS 1215085-93-0: 4-[(4R)-4-(Hydroxymethyl)-3-methyl-2,5-dioxo-4-phenyl-1-imidazolidinyl]-2-(trifluoromethyl)benzonitrile

Description:The chemical substance known as 4-[(4R)-4-(Hydroxymethyl)-3-methyl-2,5-dioxo-4-phenyl-1-imidazolidinyl]-2-(trifluoromethyl)benzonitrile, with the CAS number 1215085-93-0, is characterized by its complex molecular structure, which includes an imidazolidine ring and multiple functional groups. The presence of a hydroxymethyl group and a trifluoromethyl group contributes to its unique chemical properties, potentially influencing its reactivity and solubility. The imidazolidine moiety suggests potential biological activity, as compounds containing this ring are often explored for pharmaceutical applications. The dioxo and phenyl groups may enhance its stability and interaction with biological targets. Additionally, the trifluoromethyl group is known to increase lipophilicity, which can affect the compound's distribution in biological systems. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. However, specific data on its toxicity, solubility, and other physical properties would require experimental determination or literature references.

Formula:C₁₉H₁₄F₃N₃O₃

InChI:InChI=1S/C19H14F3N3O3/c1-24-17(28)25(14-8-7-12(10-23)15(9-14)19(20,21)22)16(27)18(24,11-26)13-5-3-2-4-6-13/h2-9,26H,11H2,1H3/t18-/m0/s1

InChI key:InChIKey=VAJGULUVTFDTAS-SFHVURJKSA-N

SMILES:N#CC1=CC=C(C=C1C(F)(F)F)N2C(=O)N(C)C(C2=O)(C=3C=CC=CC3)CO

Synonyms:
Benzonitrile, 4-[(4R)-4-(hydroxymethyl)-3-methyl-2,5-dioxo-4-phenyl-1-imidazolidinyl]-2-(trifluoromethyl)-
4-[(4R)-4-(Hydroxymethyl)-3-methyl-2,5-dioxo-4-phenyl-1-imidazolidinyl]-2-(trifluoromethyl)benzonitrile