CAS 1215092-14-0
:α-Methyl-3-nitro-<span class="text-smallcaps">L</span>-phenylalanine
Description:
α-Methyl-3-nitro-L-phenylalanine is an amino acid derivative characterized by the presence of a methyl group at the alpha position and a nitro group at the meta position of the phenyl ring. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but can serve as a useful building block in synthetic chemistry and pharmaceutical applications. The presence of the nitro group contributes to its unique reactivity and potential biological activity, making it of interest in medicinal chemistry. The compound's structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability in different environments. Additionally, the chirality of the L-phenylalanine component suggests that it may exhibit specific stereochemical properties that could affect its biological interactions. Overall, α-Methyl-3-nitro-L-phenylalanine is a compound of interest for research in both synthetic and biological chemistry due to its distinctive structural features.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c1-10(11,9(13)14)6-7-3-2-4-8(5-7)12(15)16/h2-5H,6,11H2,1H3,(H,13,14)/t10-/m0/s1
InChI key:InChIKey=RUFGGLYMLNDZAM-JTQLQIEISA-N
SMILES:C([C@](C(O)=O)(C)N)C1=CC(N(=O)=O)=CC=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.