CymitQuimica logo

CAS 1215107-57-5

:

Cyclopropanamine, 1-(2-fluorophenyl)-, hydrochloride (1:1)

Description:
Cyclopropanamine, 1-(2-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of a 2-fluorophenyl substituent indicates that a fluorine atom is attached to a phenyl ring at the second position, influencing the compound's reactivity and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would require further investigation. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or reactivity.
Formula:C9H10FN·ClH
InChI:InChI=1S/C9H10FN.ClH/c10-8-4-2-1-3-7(8)9(11)5-6-9;/h1-4H,5-6,11H2;1H
InChI key:InChIKey=FKJYBMLORZDBDU-UHFFFAOYSA-N
SMILES:NC1(C2=C(F)C=CC=C2)CC1.Cl
Synonyms:
  • Cyclopropanamine, 1-(2-fluorophenyl)-, hydrochloride (1:1)
Found 4 products.