CymitQuimica logo

CAS 1215205-10-9

:

3′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position of the biphenyl framework imparts acidic properties, making it capable of donating protons in solution. The substitution of a fluorine atom at the 3′ position and a methoxy group (-OCH₃) at the 5′ position introduces unique electronic and steric effects, influencing the compound's reactivity and solubility. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and drug development. Its molecular interactions can be further explored through techniques such as spectroscopy and chromatography. Overall, the combination of functional groups and the biphenyl backbone contributes to its potential applications in various chemical and pharmaceutical contexts.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c1-18-13-7-11(6-12(15)8-13)9-3-2-4-10(5-9)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=XTCDFBNQEJRQAG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC(OC)=CC(F)=C2
Synonyms:
  • 3′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-fluoro-5′-methoxy-
  • 3′-Fluoro-5′-methoxybiphenyl-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.