CAS 1215205-39-2

3′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 3′ position and a methoxy group at the 5′ position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The carboxylic acid functional group at the 3 position enhances its acidity and allows for hydrogen bonding, which can influence its interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, materials science, or as a building block in the development of more complex molecules. Additionally, the presence of halogen and methoxy substituents can affect the compound's electronic properties, potentially impacting its behavior in chemical reactions and interactions with other substances.

Formula: C₁₄H₁₁BrO₃

InChI: InChI=1S/C14H11BrO3/c1-18-13-7-11(6-12(15)8-13)9-3-2-4-10(5-9)14(16)17/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=HKWZVMVNLVXIAG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1)C2=CC(OC)=CC(Br)=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 3′-bromo-5′-methoxy-
• 3′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid

3'-Bromo-5'-methoxybiphenyl-3-carboxylic acid

CAS: 1215205-39-2

Formula: C₁₄H₁₁BrO₃

Molecular weight: 307.1393

Ref: IN-DA00154J