CymitQuimica logo

CAS 1215205-45-0

:

Ethyl 3-chloro-α,α-difluoro-2-methylbenzeneacetate

Description:
Ethyl 3-chloro-α,α-difluoro-2-methylbenzeneacetate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a chloro substituent and two fluorine atoms on the aromatic ring, contributing to its unique chemical properties. The presence of these halogen atoms can influence the compound's reactivity, polarity, and potential applications in various fields, including pharmaceuticals and agrochemicals. The ethyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the specific arrangement of substituents on the benzene ring can affect the compound's biological activity and interaction with other molecules. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, Ethyl 3-chloro-α,α-difluoro-2-methylbenzeneacetate represents a complex structure with diverse implications in chemical research and application.
Formula:C11H11ClF2O2
InChI:InChI=1S/C11H11ClF2O2/c1-3-16-10(15)11(13,14)8-5-4-6-9(12)7(8)2/h4-6H,3H2,1-2H3
InChI key:InChIKey=FGFPSZZQLDSXEK-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(F)(F)C1=C(C)C(Cl)=CC=C1
Synonyms:
  • Benzeneacetic acid, 3-chloro-α,α-difluoro-2-methyl-, ethyl ester
  • Ethyl 3-chloro-α,α-difluoro-2-methylbenzeneacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.