CAS 1215205-51-8

3′-Hydroxy-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-Hydroxy-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a methoxy group (-OCH₃) attached to the biphenyl framework, contributing to its chemical reactivity and potential biological activity. The carboxylic acid functional group (-COOH) at the 3-position enhances its acidity and solubility in polar solvents, making it useful in various chemical applications. The presence of multiple functional groups suggests that this compound may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point and solubility. Additionally, the specific arrangement of substituents on the biphenyl structure can affect its optical properties and reactivity, making it of interest in fields such as medicinal chemistry and materials science. Overall, this compound's unique structural features contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₂O₄

InChI: InChI=1S/C14H12O4/c1-18-13-7-11(6-12(15)8-13)9-3-2-4-10(5-9)14(16)17/h2-8,15H,1H3,(H,16,17)

InChI key: InChIKey=HBZVMOPBHNADOF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1)C2=CC(OC)=CC(O)=C2

Synonyms:

• 3′-Hydroxy-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 3′-hydroxy-5′-methoxy-

3'-Hydroxy-5'-methoxybiphenyl-3-carboxylic acid

CAS: 1215205-51-8

Formula: C₁₄H₁₂O₄

Molecular weight: 244.2427

Ref: IN-DA00155P