CAS 1215205-57-4
:7-Bromo-5-chloro-2-methyl-1H-benzimidazole
Description:
7-Bromo-5-chloro-2-methyl-1H-benzimidazole is a heterocyclic organic compound characterized by its fused benzene and imidazole rings, which contribute to its aromatic properties. The presence of bromine and chlorine substituents at the 7 and 5 positions, respectively, enhances its reactivity and potential for various chemical transformations. The methyl group at the 2 position adds to its structural complexity and can influence its solubility and biological activity. This compound is typically used in pharmaceutical research and development due to its potential as a bioactive agent. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. The compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other chemical entities. Overall, 7-Bromo-5-chloro-2-methyl-1H-benzimidazole represents a significant class of compounds in the field of organic synthesis and drug discovery.
Formula:C8H6BrClN2
InChI:InChI=1S/C8H6BrClN2/c1-4-11-7-3-5(10)2-6(9)8(7)12-4/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=CXMZJEHRYZRXJA-UHFFFAOYSA-N
SMILES:BrC1=C2C(NC(C)=N2)=CC(Cl)=C1
Synonyms:- 7-Bromo-5-chloro-2-methyl-1H-benzimidazole
- 1H-Benzimidazole, 7-bromo-5-chloro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
