CAS 1215205-65-4
:4-Bromo-1-(2,6-dichlorophenyl)-1H-pyrazole
Description:
4-Bromo-1-(2,6-dichlorophenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a dichlorophenyl group at the 1-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of halogen substituents, which can enhance biological activity or influence reactivity. The dichlorophenyl group may impart specific electronic and steric effects, making it a candidate for further research in medicinal chemistry. Additionally, the compound's reactivity can be influenced by the electron-withdrawing nature of the bromine and chlorine atoms, which may affect its interactions with other chemical species. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks.
Formula:C9H5BrCl2N2
InChI:InChI=1S/C9H5BrCl2N2/c10-6-4-13-14(5-6)9-7(11)2-1-3-8(9)12/h1-5H
InChI key:InChIKey=GPBJDPMTMSMWPY-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=CC=C1)N2C=C(Br)C=N2
Synonyms:- 1H-Pyrazole, 4-bromo-1-(2,6-dichlorophenyl)-
- 4-Bromo-1-(2,6-dichlorophenyl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
