CymitQuimica logo

CAS 1215205-67-6

:

2′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 2' position and a methoxy group at the 5' position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The carboxylic acid functional group at the 3-position enhances its acidity and polar nature, making it more soluble in polar solvents. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, the presence of halogen and methoxy substituents can affect its electronic properties, potentially making it useful in various synthetic applications or as a precursor in organic synthesis. Overall, 2′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid is a compound of interest in both academic research and industrial applications.
Formula:C14H11BrO3
InChI:InChI=1S/C14H11BrO3/c1-18-11-5-6-13(15)12(8-11)9-3-2-4-10(7-9)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=PNVILPFIXBRYAL-UHFFFAOYSA-N
SMILES:BrC=1C(=CC(OC)=CC1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-bromo-5′-methoxy-
  • 2′-Bromo-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.