CymitQuimica logo

CAS 1215205-70-1

:

5-Bromo-2-benzothiazolesulfonic acid

Description:
5-Bromo-2-benzothiazolesulfonic acid is an organic compound characterized by its sulfonic acid functional group and a bromine atom attached to a benzothiazole ring. This compound typically appears as a solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. The benzothiazole moiety contributes to its aromatic properties, making it useful in various chemical applications, including as a reagent in organic synthesis and in the development of dyes and pigments. The bromine substituent can also participate in electrophilic aromatic substitution reactions, allowing for further functionalization. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 1215205-70-1, is a unique identifier that facilitates the tracking and study of this chemical in scientific literature and databases. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.
Formula:C7H4BrNO3S2
InChI:InChI=1S/C7H4BrNO3S2/c8-4-1-2-6-5(3-4)9-7(13-6)14(10,11)12/h1-3H,(H,10,11,12)
InChI key:InChIKey=PQFRQZCBKYMUBY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1SC=2C(N1)=CC(Br)=CC2
Synonyms:
  • 2-Benzothiazolesulfonic acid, 5-bromo-
  • 5-Bromo-2-benzothiazolesulfonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.