CAS 1215205-85-8
:5-Bromo-6-methoxy-2(3H)-benzothiazolethione
Description:
5-Bromo-6-methoxy-2(3H)-benzothiazolethione is a chemical compound characterized by its unique structure, which includes a benzothiazole ring system substituted with a bromine atom and a methoxy group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiazole moiety. The bromine substitution can enhance the compound's reactivity and influence its solubility in various solvents. The methoxy group may contribute to its electronic properties, potentially affecting its interaction with biological targets. As a thione, it possesses a sulfur atom double-bonded to a carbon atom, which can participate in various chemical reactions, including nucleophilic attacks. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a precursor for synthesizing other complex molecules. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C8H6BrNOS2
InChI:InChI=1S/C8H6BrNOS2/c1-11-6-3-7-5(2-4(6)9)10-8(12)13-7/h2-3H,1H3,(H,10,12)
InChI key:InChIKey=PHAGEHCGWCLLAJ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1Br)NC(=S)S2
Synonyms:- 5-Bromo-6-methoxy-2(3H)-benzothiazolethione
- 2(3H)-Benzothiazolethione, 5-bromo-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
