CymitQuimica logo

CAS 1215205-86-9

:

3′,5′-Dimethoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′,5′-Dimethoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two methoxy groups (-OCH3) at the 3′ and 5′ positions on one of the phenyl rings contributes to its chemical properties, enhancing its solubility and reactivity. The carboxylic acid functional group (-COOH) at the 3-position of the biphenyl framework imparts acidic characteristics, allowing for potential interactions in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and materials science. Additionally, the presence of methoxy groups can influence the compound's electronic properties, potentially affecting its behavior in light absorption and emission. Overall, 3′,5′-Dimethoxy[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with significant implications in both chemical and biological contexts.
Formula:C15H14O4
InChI:InChI=1S/C15H14O4/c1-18-13-7-12(8-14(9-13)19-2)10-4-3-5-11(6-10)15(16)17/h3-9H,1-2H3,(H,16,17)
InChI key:InChIKey=VENATDFNKYVSGI-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=C(OC)C1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′,5′-dimethoxy-
  • 3′,5′-Dimethoxy[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.