CAS 1215205-88-1: 4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione

Description:4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with a bromine atom and a trifluoromethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzothiazole moiety, which is known for its applications in pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the thione functional group may impart specific chemical reactivity, such as nucleophilicity or coordination with metal ions. The compound's physical properties, such as solubility and melting point, would depend on its molecular interactions and the influence of the substituents on the benzothiazole framework. Overall, 4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione represents a class of compounds with potential utility in various chemical and biological applications.

Formula:C₈H₃BrF₃NS₂

InChI:InChI=1S/C8H3BrF3NS2/c9-4-1-3(8(10,11)12)2-5-6(4)13-7(14)15-5/h1-2H,(H,13,14)

InChI key:InChIKey=HAIZUSNDTLOTKR-UHFFFAOYSA-N

SMILES:FC(F)(F)C1=CC(Br)=C2NC(=S)SC2=C1

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2(3H)-Benzothiazolethione, 4-bromo-6-(trifluoromethyl)- REF: IN-DA00156KCAS: 1215205-88-1	- - -	To inquire	Tue 04 Mar 25
4-bromo-6-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazole-2-thione REF: 10-F638504CAS: 1215205-88-1	98%	- - -	Discontinued product
4-BroMo-2-Mercapto-6-(trifluoroMethyl)benzothiazole REF: 3D-FB92858CAS: 1215205-88-1	Min. 95%	- - -	Discontinued product