CAS 1215205-88-1: 4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione
Description:4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with a bromine atom and a trifluoromethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzothiazole moiety, which is known for its applications in pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the thione functional group may impart specific chemical reactivity, such as nucleophilicity or coordination with metal ions. The compound's physical properties, such as solubility and melting point, would depend on its molecular interactions and the influence of the substituents on the benzothiazole framework. Overall, 4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione represents a class of compounds with potential utility in various chemical and biological applications.
Formula:C8H3BrF3NS2
InChI:InChI=1S/C8H3BrF3NS2/c9-4-1-3(8(10,11)12)2-5-6(4)13-7(14)15-5/h1-2H,(H,13,14)
InChI key:InChIKey=HAIZUSNDTLOTKR-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC(Br)=C2NC(=S)SC2=C1
- Synonyms:
- 2(3H)-Benzothiazolethione, 4-bromo-6-(trifluoromethyl)-
- 4-Bromo-6-(trifluoromethyl)-2(3H)-benzothiazolethione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2(3H)-Benzothiazolethione, 4-bromo-6-(trifluoromethyl)- REF: IN-DA00156KCAS: 1215205-88-1 | - - - | To inquire | Wed 16 Apr 25 |
![]() | 4-bromo-6-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazole-2-thione REF: 10-F638504CAS: 1215205-88-1 | 98% | - - - | Discontinued product |
![]() | 4-BroMo-2-Mercapto-6-(trifluoroMethyl)benzothiazole REF: 3D-FB92858CAS: 1215205-88-1 | Min. 95% | - - - | Discontinued product |

2(3H)-Benzothiazolethione, 4-bromo-6-(trifluoromethyl)-
Ref: IN-DA00156K
Undefined size | To inquire |

4-bromo-6-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazole-2-thione
Ref: 10-F638504
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

4-BroMo-2-Mercapto-6-(trifluoroMethyl)benzothiazole
Ref: 3D-FB92858
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |