CAS 1215205-89-2
:1,1-Dimethylethyl N-(5-bromo-2-pyrimidinyl)-N-cyclopropylcarbamate
Description:
1,1-Dimethylethyl N-(5-bromo-2-pyrimidinyl)-N-cyclopropylcarbamate, identified by its CAS number 1215205-89-2, is a chemical compound that belongs to the class of carbamates. This substance features a unique structure characterized by the presence of a dimethyl group, a brominated pyrimidine ring, and a cyclopropyl group, which contribute to its potential biological activity. The bromine atom in the pyrimidine ring can enhance the compound's reactivity and influence its interaction with biological targets. The carbamate functional group is known for its role in various applications, including as a pesticide or herbicide. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, making it important for applications in agrochemicals or pharmaceuticals. Additionally, the presence of the cyclopropyl moiety may impart unique steric and electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics. Overall, this compound's specific characteristics make it of interest in medicinal chemistry and agricultural science.
Formula:C12H16BrN3O2
InChI:InChI=1S/C12H16BrN3O2/c1-12(2,3)18-11(17)16(9-4-5-9)10-14-6-8(13)7-15-10/h6-7,9H,4-5H2,1-3H3
InChI key:InChIKey=AEFKUGYFFRKJFT-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(C1CC1)C=2N=CC(Br)=CN2
Synonyms:- 1,1-Dimethylethyl N-(5-bromo-2-pyrimidinyl)-N-cyclopropylcarbamate
- Carbamic acid, N-(5-bromo-2-pyrimidinyl)-N-cyclopropyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
