CAS 1215205-90-5
:4-Bromo-6-chloro-2(3H)-benzothiazolethione
Description:
4-Bromo-6-chloro-2(3H)-benzothiazolethione is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a benzothiazole ring system. This compound features a thione functional group, which is a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential applications in various chemical reactions. The presence of halogens (bromine and chlorine) typically enhances the compound's electrophilic properties, making it useful in synthetic organic chemistry. Additionally, benzothiazole derivatives are known for their biological activities, including antimicrobial and antifungal properties, which may suggest potential pharmaceutical applications. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability in different solvents. Overall, 4-Bromo-6-chloro-2(3H)-benzothiazolethione is a valuable compound in research and development, particularly in the fields of medicinal chemistry and materials science.
Formula:C7H3BrClNS2
InChI:InChI=1S/C7H3BrClNS2/c8-4-1-3(9)2-5-6(4)10-7(11)12-5/h1-2H,(H,10,11)
InChI key:InChIKey=OEAATHCDYWJVON-UHFFFAOYSA-N
SMILES:BrC1=C2C(SC(=S)N2)=CC(Cl)=C1
Synonyms:- 4-Bromo-6-chloro-2(3H)-benzothiazolethione
- 2(3H)-Benzothiazolethione, 4-bromo-6-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
