CAS 1215205-94-9

1-Bromo-3-chloro-2-methoxy-5-nitrobenzene

Description:

1-Bromo-3-chloro-2-methoxy-5-nitrobenzene is an organic compound characterized by its complex aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of a bromine atom and a chlorine atom indicates that it is a halogenated compound, which can influence its reactivity and physical properties. The methoxy group (-OCH3) contributes to its solubility in organic solvents and can affect its electronic properties, while the nitro group (-NO2) is known for its electron-withdrawing effects, enhancing the compound's reactivity in electrophilic aromatic substitution reactions. This compound may exhibit moderate to high toxicity, typical of many halogenated aromatic compounds, and it may also be subject to environmental regulations due to its potential persistence and bioaccumulation. Its applications could range from use in organic synthesis to serving as an intermediate in the production of pharmaceuticals or agrochemicals. Proper handling and disposal are essential to mitigate any environmental or health risks associated with its use.

Formula: C₇H₅BrClNO₃

InChI: InChI=1S/C7H5BrClNO3/c1-13-7-5(8)2-4(10(11)12)3-6(7)9/h2-3H,1H3

InChI key: InChIKey=VKAIBJCWYIVBGA-UHFFFAOYSA-N

SMILES: O(C)C1=C(Br)C=C(N(=O)=O)C=C1Cl

Synonyms:

• Benzene, 1-bromo-3-chloro-2-methoxy-5-nitro-
• 1-Bromo-3-chloro-2-methoxy-5-nitrobenzene

2-Bromo-6-chloro-4-nitroanisole

CAS: 1215205-94-9

Formula: C₇H₅BrClNO₃

Molecular weight: 266.4765

Ref: IN-DA00156E