CAS 1215206-06-6

2′-Methoxy-3′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Methoxy-3′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the 2' position and a methyl group (-CH3) at the 3' position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the carboxylic acid functional group (-COOH) at the 3 position enhances its acidity and solubility in polar solvents. This compound may exhibit various chemical behaviors, including potential reactivity in esterification or amidation reactions due to the carboxylic acid group. Its structural features suggest possible applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound's molecular interactions, such as hydrogen bonding and π-π stacking, could also influence its biological activity and solubility characteristics. Overall, 2′-Methoxy-3′-methyl[1,1′-biphenyl]-3-carboxylic acid presents a versatile framework for further chemical exploration and application.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-10-5-3-8-13(14(10)18-2)11-6-4-7-12(9-11)15(16)17/h3-9H,1-2H3,(H,16,17)

InChI key: InChIKey=VZGIVELCAURNRK-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1C)C2=CC(C(O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 2′-methoxy-3′-methyl-
• 2′-Methoxy-3′-methyl[1,1′-biphenyl]-3-carboxylic acid

3-(2-Methoxy-3-methylphenyl)benzoic acid

CAS: 1215206-06-6

Formula: C₁₅H₁₄O₃

Molecular weight: 242.2699

Ref: IN-DA001563