CymitQuimica logo

CAS 1215206-07-7

:

2′-Bromo-3′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-Bromo-3′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 2′ position and a methoxy group at the 3′ position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The carboxylic acid functional group at the 3 position enhances its acidity and allows for hydrogen bonding, which can influence its interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in organic synthesis and as a building block for more complex molecules. Additionally, the presence of halogen and methoxy substituents can affect its electronic properties, potentially influencing its behavior in chemical reactions and interactions with other substances.
Formula:C14H11BrO3
InChI:InChI=1S/C14H11BrO3/c1-18-12-7-3-6-11(13(12)15)9-4-2-5-10(8-9)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=NJQGNWSMEJYWGO-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC=C1OC)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • 2′-Bromo-3′-methoxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-bromo-3′-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.