CAS 1215206-10-2
:4′-Bromo-3′-methoxy[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Bromo-3′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the para position and a methoxy group at the meta position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The carboxylic acid functional group at the 3-position of the biphenyl moiety imparts acidic properties, allowing for hydrogen bonding and increased polarity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and material science. Additionally, the presence of halogen and methoxy substituents can influence its electronic properties, making it a candidate for studies in electronic materials or as a ligand in coordination chemistry. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.
Formula:C14H11BrO3
InChI:InChI=1S/C14H11BrO3/c1-18-13-8-10(5-6-12(13)15)9-3-2-4-11(7-9)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=FLNFZDAKJAUNID-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1Br)C2=CC(C(O)=O)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 4′-bromo-3′-methoxy-
- 4′-Bromo-3′-methoxy[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
