CymitQuimica logo

CAS 1215206-12-4

:

2′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 1215206-12-4, is an organic compound characterized by the presence of a biphenyl structure substituted with a methylamino group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and amino acids, including potential solubility in polar solvents due to the carboxylic acid group. The methylamino group can influence its basicity and reactivity, making it a candidate for various chemical reactions, including amide formation and coupling reactions. The biphenyl moiety contributes to its stability and may affect its electronic properties, potentially making it useful in applications such as pharmaceuticals or agrochemicals. Additionally, the presence of both amino and carboxylic acid functionalities suggests that it may participate in hydrogen bonding, which can affect its physical properties, such as melting point and solubility. Overall, this compound's unique structure positions it as a versatile building block in organic synthesis and medicinal chemistry.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-15-13-8-3-2-7-12(13)10-5-4-6-11(9-10)14(16)17/h2-9,15H,1H3,(H,16,17)
InChI key:InChIKey=OUXPNNDERWQIOZ-UHFFFAOYSA-N
SMILES:N(C)C1=C(C2=CC(C(O)=O)=CC=C2)C=CC=C1
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-(methylamino)-
  • 2′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.