CymitQuimica logo

CAS 1215206-19-1

:

Pyridine, 2-[(4-iodo-1H-pyrazol-1-yl)methyl]-

Description:
Pyridine, 2-[(4-iodo-1H-pyrazol-1-yl)methyl]- is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the 4-iodo-1H-pyrazole moiety introduces additional reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits properties such as moderate solubility in polar organic solvents and may display distinct reactivity due to the iodine substituent, which can participate in nucleophilic substitution reactions. The nitrogen atom in the pyridine ring contributes to its basicity and potential coordination with metal ions, making it useful in coordination chemistry. Additionally, the compound may exhibit biological activity, which is common among pyridine derivatives, and could be explored for pharmaceutical applications. Its molecular structure suggests potential for further functionalization, allowing for the development of more complex derivatives. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H8IN3
InChI:InChI=1S/C9H8IN3/c10-8-5-12-13(6-8)7-9-3-1-2-4-11-9/h1-6H,7H2
InChI key:InChIKey=MMOKTRJYBYNYDX-UHFFFAOYSA-N
SMILES:C(N1N=CC(I)=C1)C2=CC=CC=N2
Synonyms:
  • Pyridine, 2-[(4-iodo-1H-pyrazol-1-yl)methyl]-
  • 2-[(4-Iodo-1H-pyrazol-1-yl)methyl]pyridine
Found 2 products.