CAS 1215206-26-0
:1,1-Dimethylethyl 2-chloro-5-fluorobenzoate
Description:
1,1-Dimethylethyl 2-chloro-5-fluorobenzoate, with the CAS number 1215206-26-0, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a benzoate moiety substituted with a chlorine atom at the 2-position and a fluorine atom at the 5-position of the aromatic ring, contributing to its unique reactivity and potential applications in various chemical processes. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its solubility and interaction with other molecules. Typically, compounds like this may exhibit properties such as moderate to low solubility in water, but higher solubility in organic solvents. Its structural characteristics suggest potential utility in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and reactivity would need to be determined through experimental methods or detailed literature for precise applications.
Formula:C11H12ClFO2
InChI:InChI=1S/C11H12ClFO2/c1-11(2,3)15-10(14)8-6-7(13)4-5-9(8)12/h4-6H,1-3H3
InChI key:InChIKey=JFEFMXISBNOWHV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)C1=C(Cl)C=CC(F)=C1
Synonyms:- 1,1-Dimethylethyl 2-chloro-5-fluorobenzoate
- Benzoic acid, 2-chloro-5-fluoro-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
