CymitQuimica logo

CAS 1215206-29-3

:

Pyridine, 2-(1H-imidazol-1-yl)-6-(trifluoromethyl)-, hydrochloride (1:1)

Description:
Pyridine, 2-(1H-imidazol-1-yl)-6-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and imidazole functional groups, which contribute to its heterocyclic nature. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit interesting pharmacological properties due to the combination of the pyridine and imidazole rings, which are known to participate in various biological interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the trifluoromethyl group can impart unique electronic properties, making it a valuable moiety in drug design. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and reactivity.
Formula:C9H6F3N3·ClH
InChI:InChI=1S/C9H6F3N3.ClH/c10-9(11,12)7-2-1-3-8(14-7)15-5-4-13-6-15;/h1-6H;1H
InChI key:InChIKey=WGLSQTCRGHONCB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC(=CC=C1)N2C=CN=C2.Cl
Synonyms:
  • Pyridine, 2-(1H-imidazol-1-yl)-6-(trifluoromethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.